C18H27F3N3O3S+ — CID 9443914
N-(3-methylbutyl)-2-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-ium-1-yl]acetamide (PubChem CID 9443914) has the molecular formula C18H27F3N3O3S+ and a molecular weight of 422.49 g/mol. Its IUPAC name is N-(3-methylbutyl)-2-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(3-methylbutyl)-2-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9443914 |
| Molecular Formula | C18H27F3N3O3S+ |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | N-(3-methylbutyl)-2-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-ium-1-yl]acetamide |
| SMILES | CC(C)CCNC(=O)C[NH+]1CCN(S(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C18H26F3N3O3S/c1-14(2)7-8-22-17(25)13-23-9-11-24(12-10-23)28(26,27)16-5-3-15(4-6-16)18(19,20)21/h3-6,14H,7-13H2,1-2H3,(H,22,25)/p+1 |
| InChIKey | SUOGXUIHVOIHIB-UHFFFAOYSA-O |
| XLogP | 0.76 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |