C19H32N3O3S+ — CID 9393696
N-(2-methylpropyl)-2-[4-(4-propylphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide (PubChem CID 9393696) has the molecular formula C19H32N3O3S+ and a molecular weight of 382.55 g/mol. Its IUPAC name is N-(2-methylpropyl)-2-[4-(4-propylphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(2-methylpropyl)-2-[4-(4-propylphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9393696 |
| Molecular Formula | C19H32N3O3S+ |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | N-(2-methylpropyl)-2-[4-(4-propylphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
| SMILES | CCCc1ccc(S(=O)(=O)N2CC[NH+](CC(=O)NCC(C)C)CC2)cc1 |
| InChI | InChI=1S/C19H31N3O3S/c1-4-5-17-6-8-18(9-7-17)26(24,25)22-12-10-21(11-13-22)15-19(23)20-14-16(2)3/h6-9,16H,4-5,10-15H2,1-3H3,(H,20,23)/p+1 |
| InChIKey | GMFWHNWZGADQPC-UHFFFAOYSA-O |
| XLogP | 0.30 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |