C17H26N3O5S+ — CID 9393606
methyl N-[2-[4-(4-propylphenyl)sulfonylpiperazin-1-ium-1-yl]acetyl]carbamate (PubChem CID 9393606) has the molecular formula C17H26N3O5S+ and a molecular weight of 384.48 g/mol. Its IUPAC name is methyl N-[2-[4-(4-propylphenyl)sulfonylpiperazin-1-ium-1-yl]acetyl]carbamate.
| Compound Name | methyl N-[2-[4-(4-propylphenyl)sulfonylpiperazin-1-ium-1-yl]acetyl]carbamate |
|---|---|
| PubChem CID | 9393606 |
| Molecular Formula | C17H26N3O5S+ |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | methyl N-[2-[4-(4-propylphenyl)sulfonylpiperazin-1-ium-1-yl]acetyl]carbamate |
| SMILES | CCCc1ccc(S(=O)(=O)N2CC[NH+](CC(=O)NC(=O)OC)CC2)cc1 |
| InChI | InChI=1S/C17H25N3O5S/c1-3-4-14-5-7-15(8-6-14)26(23,24)20-11-9-19(10-12-20)13-16(21)18-17(22)25-2/h5-8H,3-4,9-13H2,1-2H3,(H,18,21,22)/p+1 |
| InChIKey | IPFMXPXELWNMNI-UHFFFAOYSA-O |
| XLogP | -0.59 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |