C17H27N4O5S+ — CID 8746758
2-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-ium-1-yl]-N-(ethylcarbamoyl)acetamide (PubChem CID 8746758) has the molecular formula C17H27N4O5S+ and a molecular weight of 399.49 g/mol. Its IUPAC name is 2-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-ium-1-yl]-N-(ethylcarbamoyl)acetamide.
| Compound Name | 2-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-ium-1-yl]-N-(ethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 8746758 |
| Molecular Formula | C17H27N4O5S+ |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 2-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-ium-1-yl]-N-(ethylcarbamoyl)acetamide |
| SMILES | CCNC(=O)NC(=O)C[NH+]1CCN(S(=O)(=O)c2ccc(OCC)cc2)CC1 |
| InChI | InChI=1S/C17H26N4O5S/c1-3-18-17(23)19-16(22)13-20-9-11-21(12-10-20)27(24,25)15-7-5-14(6-8-15)26-4-2/h5-8H,3-4,9-13H2,1-2H3,(H2,18,19,22,23)/p+1 |
| InChIKey | ROVBVUIZYQZIFG-UHFFFAOYSA-O |
| XLogP | -1.18 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |