C20H34N3O3S+ — CID 8692184
N-[(2R)-heptan-2-yl]-2-[4-(4-methylphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide (PubChem CID 8692184) has the molecular formula C20H34N3O3S+ and a molecular weight of 396.58 g/mol. Its IUPAC name is N-[(2R)-heptan-2-yl]-2-[4-(4-methylphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide.
| Compound Name | N-[(2R)-heptan-2-yl]-2-[4-(4-methylphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8692184 |
| Molecular Formula | C20H34N3O3S+ |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | N-[(2R)-heptan-2-yl]-2-[4-(4-methylphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
| SMILES | CCCCC[C@@H](C)NC(=O)C[NH+]1CCN(S(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C20H33N3O3S/c1-4-5-6-7-18(3)21-20(24)16-22-12-14-23(15-13-22)27(25,26)19-10-8-17(2)9-11-19/h8-11,18H,4-7,12-16H2,1-3H3,(H,21,24)/p+1/t18-/m1/s1 |
| InChIKey | NRWZEWFIXJVUCF-GOSISDBHSA-O |
| XLogP | 0.97 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|