C19H26N3O4S+ — CID 8692168
N-[(1R)-1-(furan-2-yl)ethyl]-2-[4-(4-methylphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide (PubChem CID 8692168) has the molecular formula C19H26N3O4S+ and a molecular weight of 392.50 g/mol. Its IUPAC name is N-[(1R)-1-(furan-2-yl)ethyl]-2-[4-(4-methylphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide.
| Compound Name | N-[(1R)-1-(furan-2-yl)ethyl]-2-[4-(4-methylphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8692168 |
| Molecular Formula | C19H26N3O4S+ |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N-[(1R)-1-(furan-2-yl)ethyl]-2-[4-(4-methylphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[NH+](CC(=O)N[C@H](C)c3ccco3)CC2)cc1 |
| InChI | InChI=1S/C19H25N3O4S/c1-15-5-7-17(8-6-15)27(24,25)22-11-9-21(10-12-22)14-19(23)20-16(2)18-4-3-13-26-18/h3-8,13,16H,9-12,14H2,1-2H3,(H,20,23)/p+1/t16-/m1/s1 |
| InChIKey | FUJCJIKDHXPRKE-MRXNPFEDSA-O |
| XLogP | 0.35 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |