C19H24N3O3+ — CID 8597391
2-(4-benzoylpiperazin-1-ium-1-yl)-N-[(1R)-1-(furan-2-yl)ethyl]acetamide (PubChem CID 8597391) has the molecular formula C19H24N3O3+ and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-(4-benzoylpiperazin-1-ium-1-yl)-N-[(1R)-1-(furan-2-yl)ethyl]acetamide.
| Compound Name | 2-(4-benzoylpiperazin-1-ium-1-yl)-N-[(1R)-1-(furan-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 8597391 |
| Molecular Formula | C19H24N3O3+ |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 2-(4-benzoylpiperazin-1-ium-1-yl)-N-[(1R)-1-(furan-2-yl)ethyl]acetamide |
| SMILES | C[C@@H](NC(=O)C[NH+]1CCN(C(=O)c2ccccc2)CC1)c1ccco1 |
| InChI | InChI=1S/C19H23N3O3/c1-15(17-8-5-13-25-17)20-18(23)14-21-9-11-22(12-10-21)19(24)16-6-3-2-4-7-16/h2-8,13,15H,9-12,14H2,1H3,(H,20,23)/p+1/t15-/m1/s1 |
| InChIKey | VKNQITSHMOQPFB-OAHLLOKOSA-O |
| XLogP | 0.50 |
| TPSA | 66.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |