C18H27N4O3+ — CID 8597347
(2S)-2-[[2-(4-benzoylpiperazin-1-ium-1-yl)acetyl]amino]-N-ethylpropanamide (PubChem CID 8597347) has the molecular formula C18H27N4O3+ and a molecular weight of 347.44 g/mol. Its IUPAC name is (2S)-2-[[2-(4-benzoylpiperazin-1-ium-1-yl)acetyl]amino]-N-ethylpropanamide.
| Compound Name | (2S)-2-[[2-(4-benzoylpiperazin-1-ium-1-yl)acetyl]amino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 8597347 |
| Molecular Formula | C18H27N4O3+ |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | (2S)-2-[[2-(4-benzoylpiperazin-1-ium-1-yl)acetyl]amino]-N-ethylpropanamide |
| SMILES | CCNC(=O)[C@H](C)NC(=O)C[NH+]1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H26N4O3/c1-3-19-17(24)14(2)20-16(23)13-21-9-11-22(12-10-21)18(25)15-7-5-4-6-8-15/h4-8,14H,3,9-13H2,1-2H3,(H,19,24)(H,20,23)/p+1/t14-/m0/s1 |
| InChIKey | PYWYFIOWLDRZIE-AWEZNQCLSA-O |
| XLogP | -1.33 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |