C23H30N3O2+ — CID 9223397
2-(4-benzoylpiperazin-1-ium-1-yl)-N-[(1S)-1-(4-methylphenyl)propyl]acetamide (PubChem CID 9223397) has the molecular formula C23H30N3O2+ and a molecular weight of 380.51 g/mol. Its IUPAC name is 2-(4-benzoylpiperazin-1-ium-1-yl)-N-[(1S)-1-(4-methylphenyl)propyl]acetamide.
| Compound Name | 2-(4-benzoylpiperazin-1-ium-1-yl)-N-[(1S)-1-(4-methylphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 9223397 |
| Molecular Formula | C23H30N3O2+ |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 2-(4-benzoylpiperazin-1-ium-1-yl)-N-[(1S)-1-(4-methylphenyl)propyl]acetamide |
| SMILES | CC[C@H](NC(=O)C[NH+]1CCN(C(=O)c2ccccc2)CC1)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H29N3O2/c1-3-21(19-11-9-18(2)10-12-19)24-22(27)17-25-13-15-26(16-14-25)23(28)20-7-5-4-6-8-20/h4-12,21H,3,13-17H2,1-2H3,(H,24,27)/p+1/t21-/m0/s1 |
| InChIKey | JBVZRGWXLCJTTH-NRFANRHFSA-O |
| XLogP | 1.60 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |