C23H29N4O3+ — CID 9223114
2-(4-benzoylpiperazin-1-ium-1-yl)-N-methyl-N-[2-(4-methylanilino)-2-oxoethyl]acetamide (PubChem CID 9223114) has the molecular formula C23H29N4O3+ and a molecular weight of 409.51 g/mol. Its IUPAC name is 2-(4-benzoylpiperazin-1-ium-1-yl)-N-methyl-N-[2-(4-methylanilino)-2-oxoethyl]acetamide.
| Compound Name | 2-(4-benzoylpiperazin-1-ium-1-yl)-N-methyl-N-[2-(4-methylanilino)-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 9223114 |
| Molecular Formula | C23H29N4O3+ |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 2-(4-benzoylpiperazin-1-ium-1-yl)-N-methyl-N-[2-(4-methylanilino)-2-oxoethyl]acetamide |
| SMILES | Cc1ccc(NC(=O)CN(C)C(=O)C[NH+]2CCN(C(=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C23H28N4O3/c1-18-8-10-20(11-9-18)24-21(28)16-25(2)22(29)17-26-12-14-27(15-13-26)23(30)19-6-4-3-5-7-19/h3-11H,12-17H2,1-2H3,(H,24,28)/p+1 |
| InChIKey | FADTYGHPCYVLAP-UHFFFAOYSA-O |
| XLogP | 0.43 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |