C21H24FN4O3+ — CID 9223309
2-[[2-(4-benzoylpiperazin-1-ium-1-yl)acetyl]amino]-N-(4-fluorophenyl)acetamide (PubChem CID 9223309) has the molecular formula C21H24FN4O3+ and a molecular weight of 399.45 g/mol. Its IUPAC name is 2-[[2-(4-benzoylpiperazin-1-ium-1-yl)acetyl]amino]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[[2-(4-benzoylpiperazin-1-ium-1-yl)acetyl]amino]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 9223309 |
| Molecular Formula | C21H24FN4O3+ |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 2-[[2-(4-benzoylpiperazin-1-ium-1-yl)acetyl]amino]-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(C[NH+]1CCN(C(=O)c2ccccc2)CC1)NCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C21H23FN4O3/c22-17-6-8-18(9-7-17)24-19(27)14-23-20(28)15-25-10-12-26(13-11-25)21(29)16-4-2-1-3-5-16/h1-9H,10-15H2,(H,23,28)(H,24,27)/p+1 |
| InChIKey | STUTYKPKTMKJKW-UHFFFAOYSA-O |
| XLogP | -0.08 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |