C23H26FN4O3+ — CID 9022090
(E)-N-[2-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-4-ium-1-yl]-2-oxoethyl]-3-phenylprop-2-enamide (PubChem CID 9022090) has the molecular formula C23H26FN4O3+ and a molecular weight of 425.48 g/mol. Its IUPAC name is (E)-N-[2-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-4-ium-1-yl]-2-oxoethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-4-ium-1-yl]-2-oxoethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 9022090 |
| Molecular Formula | C23H26FN4O3+ |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | (E)-N-[2-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-4-ium-1-yl]-2-oxoethyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NCC(=O)N1CC[NH+](CC(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H25FN4O3/c24-19-7-9-20(10-8-19)26-22(30)17-27-12-14-28(15-13-27)23(31)16-25-21(29)11-6-18-4-2-1-3-5-18/h1-11H,12-17H2,(H,25,29)(H,26,30)/p+1/b11-6+ |
| InChIKey | RXZIDMLACPFIRA-IZZDOVSWSA-O |
| XLogP | 0.32 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|