C22H23FN3O4+ — CID 9021912
2-[4-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]piperazin-1-ium-1-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 9021912) has the molecular formula C22H23FN3O4+ and a molecular weight of 412.44 g/mol. Its IUPAC name is 2-[4-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]piperazin-1-ium-1-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[4-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]piperazin-1-ium-1-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 9021912 |
| Molecular Formula | C22H23FN3O4+ |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 2-[4-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]piperazin-1-ium-1-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(C[NH+]1CCN(C(=O)/C=C/c2ccc3c(c2)OCO3)CC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C22H22FN3O4/c23-17-3-5-18(6-4-17)24-21(27)14-25-9-11-26(12-10-25)22(28)8-2-16-1-7-19-20(13-16)30-15-29-19/h1-8,13H,9-12,14-15H2,(H,24,27)/p+1/b8-2+ |
| InChIKey | IXOWFZGUSAGBTM-KRXBUXKQSA-O |
| XLogP | 0.93 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|