C22H25FN3O3+ — CID 9021906
N-(4-fluorophenyl)-2-[4-[(E)-3-(2-methoxyphenyl)prop-2-enoyl]piperazin-1-ium-1-yl]acetamide (PubChem CID 9021906) has the molecular formula C22H25FN3O3+ and a molecular weight of 398.46 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[4-[(E)-3-(2-methoxyphenyl)prop-2-enoyl]piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[4-[(E)-3-(2-methoxyphenyl)prop-2-enoyl]piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9021906 |
| Molecular Formula | C22H25FN3O3+ |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | N-(4-fluorophenyl)-2-[4-[(E)-3-(2-methoxyphenyl)prop-2-enoyl]piperazin-1-ium-1-yl]acetamide |
| SMILES | COc1ccccc1/C=C/C(=O)N1CC[NH+](CC(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H24FN3O3/c1-29-20-5-3-2-4-17(20)6-11-22(28)26-14-12-25(13-15-26)16-21(27)24-19-9-7-18(23)8-10-19/h2-11H,12-16H2,1H3,(H,24,27)/p+1/b11-6+ |
| InChIKey | DVWZRAYEXPJHFZ-IZZDOVSWSA-O |
| XLogP | 1.21 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|