C25H32N3O3+ — CID 9022444
2-[4-[(E)-3-(2-ethoxyphenyl)prop-2-enoyl]piperazin-1-ium-1-yl]-N-(2-ethylphenyl)acetamide (PubChem CID 9022444) has the molecular formula C25H32N3O3+ and a molecular weight of 422.55 g/mol. Its IUPAC name is 2-[4-[(E)-3-(2-ethoxyphenyl)prop-2-enoyl]piperazin-1-ium-1-yl]-N-(2-ethylphenyl)acetamide.
| Compound Name | 2-[4-[(E)-3-(2-ethoxyphenyl)prop-2-enoyl]piperazin-1-ium-1-yl]-N-(2-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 9022444 |
| Molecular Formula | C25H32N3O3+ |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 2-[4-[(E)-3-(2-ethoxyphenyl)prop-2-enoyl]piperazin-1-ium-1-yl]-N-(2-ethylphenyl)acetamide |
| SMILES | CCOc1ccccc1/C=C/C(=O)N1CC[NH+](CC(=O)Nc2ccccc2CC)CC1 |
| InChI | InChI=1S/C25H31N3O3/c1-3-20-9-5-7-11-22(20)26-24(29)19-27-15-17-28(18-16-27)25(30)14-13-21-10-6-8-12-23(21)31-4-2/h5-14H,3-4,15-19H2,1-2H3,(H,26,29)/p+1/b14-13+ |
| InChIKey | DINOLNCPHZTWOK-BUHFOSPRSA-O |
| XLogP | 2.03 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|