C19H24N5O2+ — CID 9022188
N-(2-ethylphenyl)-2-[4-(pyrazine-2-carbonyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 9022188) has the molecular formula C19H24N5O2+ and a molecular weight of 354.43 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-[4-(pyrazine-2-carbonyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(2-ethylphenyl)-2-[4-(pyrazine-2-carbonyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9022188 |
| Molecular Formula | C19H24N5O2+ |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | N-(2-ethylphenyl)-2-[4-(pyrazine-2-carbonyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | CCc1ccccc1NC(=O)C[NH+]1CCN(C(=O)c2cnccn2)CC1 |
| InChI | InChI=1S/C19H23N5O2/c1-2-15-5-3-4-6-16(15)22-18(25)14-23-9-11-24(12-10-23)19(26)17-13-20-7-8-21-17/h3-8,13H,2,9-12,14H2,1H3,(H,22,25)/p+1 |
| InChIKey | KNOXHPJRBWJOST-UHFFFAOYSA-O |
| XLogP | 0.02 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |