C24H31N4O3+ — CID 8745911
2-[4-[2-(4-acetamidophenyl)acetyl]piperazin-1-ium-1-yl]-N-(2-ethylphenyl)acetamide (PubChem CID 8745911) has the molecular formula C24H31N4O3+ and a molecular weight of 423.54 g/mol. Its IUPAC name is 2-[4-[2-(4-acetamidophenyl)acetyl]piperazin-1-ium-1-yl]-N-(2-ethylphenyl)acetamide.
| Compound Name | 2-[4-[2-(4-acetamidophenyl)acetyl]piperazin-1-ium-1-yl]-N-(2-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 8745911 |
| Molecular Formula | C24H31N4O3+ |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 2-[4-[2-(4-acetamidophenyl)acetyl]piperazin-1-ium-1-yl]-N-(2-ethylphenyl)acetamide |
| SMILES | CCc1ccccc1NC(=O)C[NH+]1CCN(C(=O)Cc2ccc(NC(C)=O)cc2)CC1 |
| InChI | InChI=1S/C24H30N4O3/c1-3-20-6-4-5-7-22(20)26-23(30)17-27-12-14-28(15-13-27)24(31)16-19-8-10-21(11-9-19)25-18(2)29/h4-11H,3,12-17H2,1-2H3,(H,25,29)(H,26,30)/p+1 |
| InChIKey | WTATZBZCKJIBDH-UHFFFAOYSA-O |
| XLogP | 1.12 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |