C23H38N4O2+2 — CID 8679883
2-[4-[2-(azocan-1-ium-1-yl)acetyl]piperazin-1-ium-1-yl]-N-(2-ethylphenyl)acetamide (PubChem CID 8679883) has the molecular formula C23H38N4O2+2 and a molecular weight of 402.58 g/mol. Its IUPAC name is 2-[4-[2-(azocan-1-ium-1-yl)acetyl]piperazin-1-ium-1-yl]-N-(2-ethylphenyl)acetamide.
| Compound Name | 2-[4-[2-(azocan-1-ium-1-yl)acetyl]piperazin-1-ium-1-yl]-N-(2-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 8679883 |
| Molecular Formula | C23H38N4O2+2 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | 2-[4-[2-(azocan-1-ium-1-yl)acetyl]piperazin-1-ium-1-yl]-N-(2-ethylphenyl)acetamide |
| SMILES | CCc1ccccc1NC(=O)C[NH+]1CCN(C(=O)C[NH+]2CCCCCCC2)CC1 |
| InChI | InChI=1S/C23H36N4O2/c1-2-20-10-6-7-11-21(20)24-22(28)18-26-14-16-27(17-15-26)23(29)19-25-12-8-4-3-5-9-13-25/h6-7,10-11H,2-5,8-9,12-19H2,1H3,(H,24,28)/p+2 |
| InChIKey | HOTCHKODXLNIPJ-UHFFFAOYSA-P |
| XLogP | -0.24 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |