C24H30N3O2+ — CID 9022442
N-(2-ethylphenyl)-2-[4-[(E)-3-(2-methylphenyl)prop-2-enoyl]piperazin-1-ium-1-yl]acetamide (PubChem CID 9022442) has the molecular formula C24H30N3O2+ and a molecular weight of 392.52 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-[4-[(E)-3-(2-methylphenyl)prop-2-enoyl]piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(2-ethylphenyl)-2-[4-[(E)-3-(2-methylphenyl)prop-2-enoyl]piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9022442 |
| Molecular Formula | C24H30N3O2+ |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | N-(2-ethylphenyl)-2-[4-[(E)-3-(2-methylphenyl)prop-2-enoyl]piperazin-1-ium-1-yl]acetamide |
| SMILES | CCc1ccccc1NC(=O)C[NH+]1CCN(C(=O)/C=C/c2ccccc2C)CC1 |
| InChI | InChI=1S/C24H29N3O2/c1-3-20-9-6-7-11-22(20)25-23(28)18-26-14-16-27(17-15-26)24(29)13-12-21-10-5-4-8-19(21)2/h4-13H,3,14-18H2,1-2H3,(H,25,28)/p+1/b13-12+ |
| InChIKey | REAAQDQVYSTCJE-OUKQBFOZSA-O |
| XLogP | 1.94 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|