C25H32N3O3+ — CID 9021706
N-(2,6-dimethylphenyl)-2-[4-[(E)-3-(2-ethoxyphenyl)prop-2-enoyl]piperazin-1-ium-1-yl]acetamide (PubChem CID 9021706) has the molecular formula C25H32N3O3+ and a molecular weight of 422.55 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[4-[(E)-3-(2-ethoxyphenyl)prop-2-enoyl]piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[4-[(E)-3-(2-ethoxyphenyl)prop-2-enoyl]piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9021706 |
| Molecular Formula | C25H32N3O3+ |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[4-[(E)-3-(2-ethoxyphenyl)prop-2-enoyl]piperazin-1-ium-1-yl]acetamide |
| SMILES | CCOc1ccccc1/C=C/C(=O)N1CC[NH+](CC(=O)Nc2c(C)cccc2C)CC1 |
| InChI | InChI=1S/C25H31N3O3/c1-4-31-22-11-6-5-10-21(22)12-13-24(30)28-16-14-27(15-17-28)18-23(29)26-25-19(2)8-7-9-20(25)3/h5-13H,4,14-18H2,1-3H3,(H,26,29)/p+1/b13-12+ |
| InChIKey | QNNKBQVXTPSUGX-OUKQBFOZSA-O |
| XLogP | 2.08 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|