C23H28N2O4S — CID 74491221
1-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]-3-(2-ethoxyphenyl)prop-2-en-1-one (PubChem CID 74491221) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is 1-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]-3-(2-ethoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]-3-(2-ethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 74491221 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 1-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]-3-(2-ethoxyphenyl)prop-2-en-1-one |
| SMILES | CCOc1ccccc1C=CC(=O)N1CCN(S(=O)(=O)c2ccc(C)c(C)c2)CC1 |
| InChI | InChI=1S/C23H28N2O4S/c1-4-29-22-8-6-5-7-20(22)10-12-23(26)24-13-15-25(16-14-24)30(27,28)21-11-9-18(2)19(3)17-21/h5-12,17H,4,13-16H2,1-3H3 |
| InChIKey | HBUVHWYLADTJAM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|