C24H25N3O5S — CID 55510949
1-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-3-quinolin-8-ylprop-2-en-1-one (PubChem CID 55510949) has the molecular formula C24H25N3O5S and a molecular weight of 467.55 g/mol. Its IUPAC name is 1-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-3-quinolin-8-ylprop-2-en-1-one.
| Compound Name | 1-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-3-quinolin-8-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 55510949 |
| Molecular Formula | C24H25N3O5S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 1-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-3-quinolin-8-ylprop-2-en-1-one |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(=O)C=Cc3cccc4cccnc34)CC2)cc1OC |
| InChI | InChI=1S/C24H25N3O5S/c1-31-21-10-9-20(17-22(21)32-2)33(29,30)27-15-13-26(14-16-27)23(28)11-8-19-6-3-5-18-7-4-12-25-24(18)19/h3-12,17H,13-16H2,1-2H3 |
| InChIKey | NCVYIJXPSZFBPG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|