C23H23N3O5S — CID 24627113
(E)-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-3-quinolin-8-ylprop-2-enamide (PubChem CID 24627113) has the molecular formula C23H23N3O5S and a molecular weight of 453.52 g/mol. Its IUPAC name is (E)-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-3-quinolin-8-ylprop-2-enamide.
| Compound Name | (E)-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-3-quinolin-8-ylprop-2-enamide |
|---|---|
| PubChem CID | 24627113 |
| Molecular Formula | C23H23N3O5S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | (E)-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-3-quinolin-8-ylprop-2-enamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)/C=C/c1cccc2cccnc12 |
| InChI | InChI=1S/C23H23N3O5S/c1-30-21-9-8-19(32(28,29)26-12-14-31-15-13-26)16-20(21)25-22(27)10-7-18-5-2-4-17-6-3-11-24-23(17)18/h2-11,16H,12-15H2,1H3,(H,25,27)/b10-7+ |
| InChIKey | RPPFUJINMZMMOV-JXMROGBWSA-N |
| XLogP | 2.92 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|