C18H20N4O8S — CID 3974867
N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-2-[(2-nitro-3-pyridinyl)oxy]acetamide (PubChem CID 3974867) has the molecular formula C18H20N4O8S and a molecular weight of 452.45 g/mol. Its IUPAC name is N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-2-[(2-nitro-3-pyridinyl)oxy]acetamide.
| Compound Name | N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-2-[(2-nitro-3-pyridinyl)oxy]acetamide |
|---|---|
| PubChem CID | 3974867 |
| Molecular Formula | C18H20N4O8S |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-2-[(2-nitro-3-pyridinyl)oxy]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)COc1cccnc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H20N4O8S/c1-28-15-5-4-13(31(26,27)21-7-9-29-10-8-21)11-14(15)20-17(23)12-30-16-3-2-6-19-18(16)22(24)25/h2-6,11H,7-10,12H2,1H3,(H,20,23) |
| InChIKey | KFYIDMNEXCAYLX-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 150.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|