C20H23ClN2O6S — CID 16547841
2-(4-chloro-2-methylphenoxy)-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)acetamide (PubChem CID 16547841) has the molecular formula C20H23ClN2O6S and a molecular weight of 454.93 g/mol. Its IUPAC name is 2-(4-chloro-2-methylphenoxy)-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)acetamide.
| Compound Name | 2-(4-chloro-2-methylphenoxy)-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 16547841 |
| Molecular Formula | C20H23ClN2O6S |
| Molecular Weight | 454.93 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 2-(4-chloro-2-methylphenoxy)-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)COc1ccc(Cl)cc1C |
| InChI | InChI=1S/C20H23ClN2O6S/c1-14-11-15(21)3-5-18(14)29-13-20(24)22-17-12-16(4-6-19(17)27-2)30(25,26)23-7-9-28-10-8-23/h3-6,11-12H,7-10,13H2,1-2H3,(H,22,24) |
| InChIKey | UUFFCAIOQCSVJQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.93 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |