C16H19N5O7S — CID 24669560
N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-2-(4-nitroimidazol-1-yl)acetamide (PubChem CID 24669560) has the molecular formula C16H19N5O7S and a molecular weight of 425.42 g/mol. Its IUPAC name is N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-2-(4-nitroimidazol-1-yl)acetamide.
| Compound Name | N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-2-(4-nitroimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 24669560 |
| Molecular Formula | C16H19N5O7S |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-2-(4-nitroimidazol-1-yl)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)Cn1cnc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H19N5O7S/c1-27-14-3-2-12(29(25,26)20-4-6-28-7-5-20)8-13(14)18-16(22)10-19-9-15(17-11-19)21(23)24/h2-3,8-9,11H,4-7,10H2,1H3,(H,18,22) |
| InChIKey | XBNFDICLJKMJTP-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 145.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|