C20H23N3O5S — CID 39443903
(E)-1-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-3-pyridin-4-ylprop-2-en-1-one (PubChem CID 39443903) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is (E)-1-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-3-pyridin-4-ylprop-2-en-1-one.
| Compound Name | (E)-1-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-3-pyridin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 39443903 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | (E)-1-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-3-pyridin-4-ylprop-2-en-1-one |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(=O)/C=C/c3ccncc3)CC2)cc1OC |
| InChI | InChI=1S/C20H23N3O5S/c1-27-18-5-4-17(15-19(18)28-2)29(25,26)23-13-11-22(12-14-23)20(24)6-3-16-7-9-21-10-8-16/h3-10,15H,11-14H2,1-2H3/b6-3+ |
| InChIKey | REXCXMUTLRTVBI-ZZXKWVIFSA-N |
| XLogP | 1.65 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|