C21H28N4O5S — CID 71843475
3-(3,4-dimethoxyphenyl)-1-[4-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 71843475) has the molecular formula C21H28N4O5S and a molecular weight of 448.55 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-1-[4-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)-1-[4-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 71843475 |
| Molecular Formula | C21H28N4O5S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-1-[4-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | COc1ccc(C=CC(=O)N2CCN(S(=O)(=O)c3c(C)nn(C)c3C)CC2)cc1OC |
| InChI | InChI=1S/C21H28N4O5S/c1-15-21(16(2)23(3)22-15)31(27,28)25-12-10-24(11-13-25)20(26)9-7-17-6-8-18(29-4)19(14-17)30-5/h6-9,14H,10-13H2,1-5H3 |
| InChIKey | KUHLTZUFPXKJTP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 93.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|