C20H25ClN4O3S — CID 117054998
(E)-3-(2-chlorophenyl)-1-[4-(1,3,5-trimethylpyrazol-4-yl)sulfonyl-1,4-diazepan-1-yl]prop-2-en-1-one (PubChem CID 117054998) has the molecular formula C20H25ClN4O3S and a molecular weight of 436.97 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-1-[4-(1,3,5-trimethylpyrazol-4-yl)sulfonyl-1,4-diazepan-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2-chlorophenyl)-1-[4-(1,3,5-trimethylpyrazol-4-yl)sulfonyl-1,4-diazepan-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 117054998 |
| Molecular Formula | C20H25ClN4O3S |
| Molecular Weight | 436.97 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-1-[4-(1,3,5-trimethylpyrazol-4-yl)sulfonyl-1,4-diazepan-1-yl]prop-2-en-1-one |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)N1CCCN(C(=O)/C=C/c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C20H25ClN4O3S/c1-15-20(16(2)23(3)22-15)29(27,28)25-12-6-11-24(13-14-25)19(26)10-9-17-7-4-5-8-18(17)21/h4-5,7-10H,6,11-14H2,1-3H3/b10-9+ |
| InChIKey | CUHDHUYXQOBWQG-MDZDMXLPSA-N |
| XLogP | 2.63 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.97 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|