C23H27ClN2O3S — CID 2674268
(E)-3-(2-chlorophenyl)-1-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 2674268) has the molecular formula C23H27ClN2O3S and a molecular weight of 447.00 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-1-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2-chlorophenyl)-1-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 2674268 |
| Molecular Formula | C23H27ClN2O3S |
| Molecular Weight | 447.00 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-1-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N2CCN(C(=O)/C=C/c3ccccc3Cl)CC2)c1C |
| InChI | InChI=1S/C23H27ClN2O3S/c1-16-15-17(2)19(4)23(18(16)3)30(28,29)26-13-11-25(12-14-26)22(27)10-9-20-7-5-6-8-21(20)24/h5-10,15H,11-14H2,1-4H3/b10-9+ |
| InChIKey | LWQJMZKNUSDFFZ-MDZDMXLPSA-N |
| XLogP | 4.12 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.00 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|