C20H26N4O5S — CID 117054947
(E)-3-(3,4-dimethoxyphenyl)-1-[4-(1-methylimidazol-4-yl)sulfonyl-1,4-diazepan-1-yl]prop-2-en-1-one (PubChem CID 117054947) has the molecular formula C20H26N4O5S and a molecular weight of 434.52 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-1-[4-(1-methylimidazol-4-yl)sulfonyl-1,4-diazepan-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-1-[4-(1-methylimidazol-4-yl)sulfonyl-1,4-diazepan-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 117054947 |
| Molecular Formula | C20H26N4O5S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-1-[4-(1-methylimidazol-4-yl)sulfonyl-1,4-diazepan-1-yl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)N2CCCN(S(=O)(=O)c3cn(C)cn3)CC2)cc1OC |
| InChI | InChI=1S/C20H26N4O5S/c1-22-14-19(21-15-22)30(26,27)24-10-4-9-23(11-12-24)20(25)8-6-16-5-7-17(28-2)18(13-16)29-3/h5-8,13-15H,4,9-12H2,1-3H3/b8-6+ |
| InChIKey | ICJUNTDMOUOUSJ-SOFGYWHQSA-N |
| XLogP | 1.37 |
| TPSA | 93.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|