C22H30N4O6S — CID 117054934
(E)-1-[4-(1,2-dimethylimidazol-4-yl)sulfonyl-1,4-diazepan-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 117054934) has the molecular formula C22H30N4O6S and a molecular weight of 478.57 g/mol. Its IUPAC name is (E)-1-[4-(1,2-dimethylimidazol-4-yl)sulfonyl-1,4-diazepan-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(1,2-dimethylimidazol-4-yl)sulfonyl-1,4-diazepan-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 117054934 |
| Molecular Formula | C22H30N4O6S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | (E)-1-[4-(1,2-dimethylimidazol-4-yl)sulfonyl-1,4-diazepan-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)N2CCCN(S(=O)(=O)c3cn(C)c(C)n3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C22H30N4O6S/c1-16-23-20(15-24(16)2)33(28,29)26-10-6-9-25(11-12-26)21(27)8-7-17-13-18(30-3)22(32-5)19(14-17)31-4/h7-8,13-15H,6,9-12H2,1-5H3/b8-7+ |
| InChIKey | VICDFVNQAOYYFL-BQYQJAHWSA-N |
| XLogP | 1.69 |
| TPSA | 103.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|