C23H27ClN2O4 — CID 55918519
(E)-3-(3-chloro-4,5-dimethoxyphenyl)-1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]prop-2-en-1-one (PubChem CID 55918519) has the molecular formula C23H27ClN2O4 and a molecular weight of 430.93 g/mol. Its IUPAC name is (E)-3-(3-chloro-4,5-dimethoxyphenyl)-1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 55918519 |
| Molecular Formula | C23H27ClN2O4 |
| Molecular Weight | 430.93 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]prop-2-en-1-one |
| SMILES | COc1ccc(N2CCCN(C(=O)/C=C/c3cc(Cl)c(OC)c(OC)c3)CC2)cc1 |
| InChI | InChI=1S/C23H27ClN2O4/c1-28-19-8-6-18(7-9-19)25-11-4-12-26(14-13-25)22(27)10-5-17-15-20(24)23(30-3)21(16-17)29-2/h5-10,15-16H,4,11-14H2,1-3H3/b10-5+ |
| InChIKey | JNPJLGPBAIYHAU-BJMVGYQFSA-N |
| XLogP | 4.12 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.93 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|