C20H21ClN2O4S — CID 9022799
(E)-3-(3-chloro-4,5-dimethoxyphenyl)-1-[4-(thiophene-2-carbonyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 9022799) has the molecular formula C20H21ClN2O4S and a molecular weight of 420.92 g/mol. Its IUPAC name is (E)-3-(3-chloro-4,5-dimethoxyphenyl)-1-[4-(thiophene-2-carbonyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-1-[4-(thiophene-2-carbonyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 9022799 |
| Molecular Formula | C20H21ClN2O4S |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-1-[4-(thiophene-2-carbonyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)N2CCN(C(=O)c3cccs3)CC2)cc(Cl)c1OC |
| InChI | InChI=1S/C20H21ClN2O4S/c1-26-16-13-14(12-15(21)19(16)27-2)5-6-18(24)22-7-9-23(10-8-22)20(25)17-4-3-11-28-17/h3-6,11-13H,7-10H2,1-2H3/b6-5+ |
| InChIKey | CMSKHVOQXIBZLD-AATRIKPKSA-N |
| XLogP | 3.42 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|