C32H42N2O8 — CID 162851522
3-(3,4,5-trimethoxyphenyl)-1-[6-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]-1,6-diazecan-1-yl]prop-2-en-1-one (PubChem CID 162851522) has the molecular formula C32H42N2O8 and a molecular weight of 582.69 g/mol. Its IUPAC name is 3-(3,4,5-trimethoxyphenyl)-1-[6-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]-1,6-diazecan-1-yl]prop-2-en-1-one.
| Compound Name | 3-(3,4,5-trimethoxyphenyl)-1-[6-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]-1,6-diazecan-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 162851522 |
| Molecular Formula | C32H42N2O8 |
| Molecular Weight | 582.69 g/mol |
| Exact Mass | 582.29 |
| IUPAC Name | 3-(3,4,5-trimethoxyphenyl)-1-[6-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]-1,6-diazecan-1-yl]prop-2-en-1-one |
| SMILES | COc1cc(C=CC(=O)N2CCCCN(C(=O)C=Cc3cc(OC)c(OC)c(OC)c3)CCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C32H42N2O8/c1-37-25-19-23(20-26(38-2)31(25)41-5)11-13-29(35)33-15-7-9-17-34(18-10-8-16-33)30(36)14-12-24-21-27(39-3)32(42-6)28(22-24)40-4/h11-14,19-22H,7-10,15-18H2,1-6H3 |
| InChIKey | NDZFQLPXVCQIPU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 96.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.69 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|