C21H27NO4 — CID 118715509
(2E,4E,6E)-1-piperidin-1-yl-7-(3,4,5-trimethoxyphenyl)hepta-2,4,6-trien-1-one (PubChem CID 118715509) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is (2E,4E,6E)-1-piperidin-1-yl-7-(3,4,5-trimethoxyphenyl)hepta-2,4,6-trien-1-one.
| Compound Name | (2E,4E,6E)-1-piperidin-1-yl-7-(3,4,5-trimethoxyphenyl)hepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 118715509 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | (2E,4E,6E)-1-piperidin-1-yl-7-(3,4,5-trimethoxyphenyl)hepta-2,4,6-trien-1-one |
| SMILES | COc1cc(/C=C/C=C/C=C/C(=O)N2CCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C21H27NO4/c1-24-18-15-17(16-19(25-2)21(18)26-3)11-7-4-5-8-12-20(23)22-13-9-6-10-14-22/h4-5,7-8,11-12,15-16H,6,9-10,13-14H2,1-3H3/b5-4+,11-7+,12-8+ |
| InChIKey | AMEYSMZVVFPVSM-XAWLDFMPSA-N |
| XLogP | 3.85 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|