C14H16O5 — CID 15257506
(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoic acid (PubChem CID 15257506) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is (2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 15257506 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoic acid |
| SMILES | COc1cc(/C=C/C=C/C(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C14H16O5/c1-17-11-8-10(6-4-5-7-13(15)16)9-12(18-2)14(11)19-3/h4-9H,1-3H3,(H,15,16)/b6-4+,7-5+ |
| InChIKey | WQIHERMZQSQZPC-YDFGWWAZSA-N |
| XLogP | 2.37 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|