(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoic acid

C14H16O5 — CID 15257506

IUPAC(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoic acid
SMILESCOc1cc(/C=C/C=C/C(=O)O)cc(OC)c1OC
InChIInChI=1S/C14H16O5/c1-17-11-8-10(6-4-5-7-13(15)16)9-12(18-2)14(11)19-3/h4-9H,1-3H3,(H,15,16)/b6-4+,7-5+
InChIKeyWQIHERMZQSQZPC-YDFGWWAZSA-N
MW264.28 g/mol
LogP2.37
Rot. Bonds6

About (2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoic acid

(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoic acid (PubChem CID 15257506) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is (2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoic acid.

Molecular Properties

Compound Name(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoic acid
PubChem CID15257506
Molecular FormulaC14H16O5
Molecular Weight264.28 g/mol
Exact Mass264.10
IUPAC Name(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoic acid
SMILESCOc1cc(/C=C/C=C/C(=O)O)cc(OC)c1OC
InChIInChI=1S/C14H16O5/c1-17-11-8-10(6-4-5-7-13(15)16)9-12(18-2)14(11)19-3/h4-9H,1-3H3,(H,15,16)/b6-4+,7-5+
InChIKeyWQIHERMZQSQZPC-YDFGWWAZSA-N
XLogP2.37
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.28
LogP ≤ 52.37
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoic acid?
The IUPAC name of (2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoic acid (CID 15257506) is (2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoic acid.
What is the SMILES notation for (2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoic acid?
The canonical SMILES for (2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoic acid is COc1cc(/C=C/C=C/C(=O)O)cc(OC)c1OC.
What is the InChIKey of (2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoic acid?
The InChIKey is WQIHERMZQSQZPC-YDFGWWAZSA-N. The full InChI is InChI=1S/C14H16O5/c1-17-11-8-10(6-4-5-7-13(15)16)9-12(18-2)14(11)19-3/h4-9H,1-3H3,(H,15,16)/b6-4+,7-5+.
What are the key properties of (2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoic acid?
(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoic acid has a molecular weight of 264.28 g/mol, XLogP of 2.37, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoic acid is sourced from PubChem (CID 15257506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).