C34H42N2O8 — CID 73448077
5-(3,4,5-trimethoxyphenyl)-N-[2-[5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoylamino]cyclohexyl]penta-2,4-dienamide (PubChem CID 73448077) has the molecular formula C34H42N2O8 and a molecular weight of 606.72 g/mol. Its IUPAC name is 5-(3,4,5-trimethoxyphenyl)-N-[2-[5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoylamino]cyclohexyl]penta-2,4-dienamide.
| Compound Name | 5-(3,4,5-trimethoxyphenyl)-N-[2-[5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoylamino]cyclohexyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 73448077 |
| Molecular Formula | C34H42N2O8 |
| Molecular Weight | 606.72 g/mol |
| Exact Mass | 606.29 |
| IUPAC Name | 5-(3,4,5-trimethoxyphenyl)-N-[2-[5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoylamino]cyclohexyl]penta-2,4-dienamide |
| SMILES | COc1cc(C=CC=CC(=O)NC2CCCCC2NC(=O)C=CC=Cc2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C34H42N2O8/c1-39-27-19-23(20-28(40-2)33(27)43-5)13-7-11-17-31(37)35-25-15-9-10-16-26(25)36-32(38)18-12-8-14-24-21-29(41-3)34(44-6)30(22-24)42-4/h7-8,11-14,17-22,25-26H,9-10,15-16H2,1-6H3,(H,35,37)(H,36,38) |
| InChIKey | QDJAVDFLAOLYDT-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.72 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|