C19H25NO6 — CID 75303877
2-[3-(3,4,5-trimethoxyphenyl)prop-2-enoylamino]cyclohexane-1-carboxylic acid (PubChem CID 75303877) has the molecular formula C19H25NO6 and a molecular weight of 363.41 g/mol. Its IUPAC name is 2-[3-(3,4,5-trimethoxyphenyl)prop-2-enoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[3-(3,4,5-trimethoxyphenyl)prop-2-enoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 75303877 |
| Molecular Formula | C19H25NO6 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 2-[3-(3,4,5-trimethoxyphenyl)prop-2-enoylamino]cyclohexane-1-carboxylic acid |
| SMILES | COc1cc(C=CC(=O)NC2CCCCC2C(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C19H25NO6/c1-24-15-10-12(11-16(25-2)18(15)26-3)8-9-17(21)20-14-7-5-4-6-13(14)19(22)23/h8-11,13-14H,4-7H2,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | JLSQVZCQCVVCBA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|