C18H25NO3 — CID 8004597
(E)-3-(2,3-dimethoxyphenyl)-N-[(1S,2S)-2-methylcyclohexyl]prop-2-enamide (PubChem CID 8004597) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is (E)-3-(2,3-dimethoxyphenyl)-N-[(1S,2S)-2-methylcyclohexyl]prop-2-enamide.
| Compound Name | (E)-3-(2,3-dimethoxyphenyl)-N-[(1S,2S)-2-methylcyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 8004597 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (E)-3-(2,3-dimethoxyphenyl)-N-[(1S,2S)-2-methylcyclohexyl]prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)N[C@H]2CCCC[C@@H]2C)c1OC |
| InChI | InChI=1S/C18H25NO3/c1-13-7-4-5-9-15(13)19-17(20)12-11-14-8-6-10-16(21-2)18(14)22-3/h6,8,10-13,15H,4-5,7,9H2,1-3H3,(H,19,20)/b12-11+/t13-,15-/m0/s1 |
| InChIKey | LZNPARYURBGVLA-BJKSPJJASA-N |
| XLogP | 3.41 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|