C17H25NO4 — CID 8023831
2,3,4-trimethoxy-N-[(1S,2R)-2-methylcyclohexyl]benzamide (PubChem CID 8023831) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is 2,3,4-trimethoxy-N-[(1S,2R)-2-methylcyclohexyl]benzamide.
| Compound Name | 2,3,4-trimethoxy-N-[(1S,2R)-2-methylcyclohexyl]benzamide |
|---|---|
| PubChem CID | 8023831 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 2,3,4-trimethoxy-N-[(1S,2R)-2-methylcyclohexyl]benzamide |
| SMILES | COc1ccc(C(=O)N[C@H]2CCCC[C@H]2C)c(OC)c1OC |
| InChI | InChI=1S/C17H25NO4/c1-11-7-5-6-8-13(11)18-17(19)12-9-10-14(20-2)16(22-4)15(12)21-3/h9-11,13H,5-8H2,1-4H3,(H,18,19)/t11-,13+/m1/s1 |
| InChIKey | QQNOQZHTSVRVFT-YPMHNXCESA-N |
| XLogP | 3.02 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |