C16H23NO3 — CID 40793133
2,4-dimethoxy-N-[(1S,2R)-2-methylcyclohexyl]benzamide (PubChem CID 40793133) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 2,4-dimethoxy-N-[(1S,2R)-2-methylcyclohexyl]benzamide.
| Compound Name | 2,4-dimethoxy-N-[(1S,2R)-2-methylcyclohexyl]benzamide |
|---|---|
| PubChem CID | 40793133 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 2,4-dimethoxy-N-[(1S,2R)-2-methylcyclohexyl]benzamide |
| SMILES | COc1ccc(C(=O)N[C@H]2CCCC[C@H]2C)c(OC)c1 |
| InChI | InChI=1S/C16H23NO3/c1-11-6-4-5-7-14(11)17-16(18)13-9-8-12(19-2)10-15(13)20-3/h8-11,14H,4-7H2,1-3H3,(H,17,18)/t11-,14+/m1/s1 |
| InChIKey | SVGAUMBTHRCBIT-RISCZKNCSA-N |
| XLogP | 3.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |