C14H19NO4 — CID 104956910
2-hydroxy-N-[(1S,2S)-2-hydroxycyclohexyl]-4-methoxybenzamide (PubChem CID 104956910) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 2-hydroxy-N-[(1S,2S)-2-hydroxycyclohexyl]-4-methoxybenzamide.
| Compound Name | 2-hydroxy-N-[(1S,2S)-2-hydroxycyclohexyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 104956910 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 2-hydroxy-N-[(1S,2S)-2-hydroxycyclohexyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N[C@H]2CCCC[C@@H]2O)c(O)c1 |
| InChI | InChI=1S/C14H19NO4/c1-19-9-6-7-10(13(17)8-9)14(18)15-11-4-2-3-5-12(11)16/h6-8,11-12,16-17H,2-5H2,1H3,(H,15,18)/t11-,12-/m0/s1 |
| InChIKey | NTKVASMEDDGDFE-RYUDHWBXSA-N |
| XLogP | 1.43 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |