C16H23NO3 — CID 79877931
N-(2,2-dimethylcyclohexyl)-2-hydroxy-4-methoxybenzamide (PubChem CID 79877931) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is N-(2,2-dimethylcyclohexyl)-2-hydroxy-4-methoxybenzamide.
| Compound Name | N-(2,2-dimethylcyclohexyl)-2-hydroxy-4-methoxybenzamide |
|---|---|
| PubChem CID | 79877931 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | N-(2,2-dimethylcyclohexyl)-2-hydroxy-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2CCCCC2(C)C)c(O)c1 |
| InChI | InChI=1S/C16H23NO3/c1-16(2)9-5-4-6-14(16)17-15(19)12-8-7-11(20-3)10-13(12)18/h7-8,10,14,18H,4-6,9H2,1-3H3,(H,17,19) |
| InChIKey | NYKBVISVFXISDF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |