C17H24N2O4 — CID 119457461
N-(8-azabicyclo[3.2.1]octan-3-yl)-2,3,4-trimethoxybenzamide (PubChem CID 119457461) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-2,3,4-trimethoxybenzamide.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-2,3,4-trimethoxybenzamide |
|---|---|
| PubChem CID | 119457461 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-2,3,4-trimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2CC3CCC(C2)N3)c(OC)c1OC |
| InChI | InChI=1S/C17H24N2O4/c1-21-14-7-6-13(15(22-2)16(14)23-3)17(20)19-12-8-10-4-5-11(9-12)18-10/h6-7,10-12,18H,4-5,8-9H2,1-3H3,(H,19,20) |
| InChIKey | BRJRIWFWUMZSQH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |