C19H28N2O6 — CID 146142219
tert-butyl N-[3-[(2,3,4-trimethoxybenzoyl)amino]cyclobutyl]carbamate (PubChem CID 146142219) has the molecular formula C19H28N2O6 and a molecular weight of 380.44 g/mol. Its IUPAC name is tert-butyl N-[3-[(2,3,4-trimethoxybenzoyl)amino]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[3-[(2,3,4-trimethoxybenzoyl)amino]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 146142219 |
| Molecular Formula | C19H28N2O6 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | tert-butyl N-[3-[(2,3,4-trimethoxybenzoyl)amino]cyclobutyl]carbamate |
| SMILES | COc1ccc(C(=O)NC2CC(NC(=O)OC(C)(C)C)C2)c(OC)c1OC |
| InChI | InChI=1S/C19H28N2O6/c1-19(2,3)27-18(23)21-12-9-11(10-12)20-17(22)13-7-8-14(24-4)16(26-6)15(13)25-5/h7-8,11-12H,9-10H2,1-6H3,(H,20,22)(H,21,23) |
| InChIKey | FPDOKPKLLRLUQO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |