C18H27NO3 — CID 139378064
tert-butyl N-[(1R,3S)-3-(2-methoxyphenyl)cyclohexyl]carbamate (PubChem CID 139378064) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is tert-butyl N-[(1R,3S)-3-(2-methoxyphenyl)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R,3S)-3-(2-methoxyphenyl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 139378064 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | tert-butyl N-[(1R,3S)-3-(2-methoxyphenyl)cyclohexyl]carbamate |
| SMILES | COc1ccccc1[C@H]1CCC[C@@H](NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H27NO3/c1-18(2,3)22-17(20)19-14-9-7-8-13(12-14)15-10-5-6-11-16(15)21-4/h5-6,10-11,13-14H,7-9,12H2,1-4H3,(H,19,20)/t13-,14+/m0/s1 |
| InChIKey | ZNURGZUWLGCHBC-UONOGXRCSA-N |
| XLogP | 4.25 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |