C19H29N3O3 — CID 113247856
tert-butyl N-[3-(4-acetamidoanilino)cyclohexyl]carbamate (PubChem CID 113247856) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is tert-butyl N-[3-(4-acetamidoanilino)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-acetamidoanilino)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 113247856 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | tert-butyl N-[3-(4-acetamidoanilino)cyclohexyl]carbamate |
| SMILES | CC(=O)Nc1ccc(NC2CCCC(NC(=O)OC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C19H29N3O3/c1-13(23)20-14-8-10-15(11-9-14)21-16-6-5-7-17(12-16)22-18(24)25-19(2,3)4/h8-11,16-17,21H,5-7,12H2,1-4H3,(H,20,23)(H,22,24) |
| InChIKey | PTIGMZRZWVYPLN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |