C22H34N2O3 — CID 124675025
tert-butyl N-[(1S,3S)-3-[(4-tert-butylbenzoyl)amino]cyclohexyl]carbamate (PubChem CID 124675025) has the molecular formula C22H34N2O3 and a molecular weight of 374.53 g/mol. Its IUPAC name is tert-butyl N-[(1S,3S)-3-[(4-tert-butylbenzoyl)amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1S,3S)-3-[(4-tert-butylbenzoyl)amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 124675025 |
| Molecular Formula | C22H34N2O3 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | tert-butyl N-[(1S,3S)-3-[(4-tert-butylbenzoyl)amino]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCC[C@H](NC(=O)c2ccc(C(C)(C)C)cc2)C1 |
| InChI | InChI=1S/C22H34N2O3/c1-21(2,3)16-12-10-15(11-13-16)19(25)23-17-8-7-9-18(14-17)24-20(26)27-22(4,5)6/h10-13,17-18H,7-9,14H2,1-6H3,(H,23,25)(H,24,26)/t17-,18-/m0/s1 |
| InChIKey | PBJSLNLAQJNGRW-ROUUACIJSA-N |
| XLogP | 4.55 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |