C23H28FN3O3 — CID 143913711
tert-butyl N-[(1S)-3-[[6-(3-fluorophenyl)pyridine-3-carbonyl]amino]cyclohexyl]carbamate (PubChem CID 143913711) has the molecular formula C23H28FN3O3 and a molecular weight of 413.49 g/mol. Its IUPAC name is tert-butyl N-[(1S)-3-[[6-(3-fluorophenyl)pyridine-3-carbonyl]amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-3-[[6-(3-fluorophenyl)pyridine-3-carbonyl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 143913711 |
| Molecular Formula | C23H28FN3O3 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | tert-butyl N-[(1S)-3-[[6-(3-fluorophenyl)pyridine-3-carbonyl]amino]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCC(NC(=O)c2ccc(-c3cccc(F)c3)nc2)C1 |
| InChI | InChI=1S/C23H28FN3O3/c1-23(2,3)30-22(29)27-19-9-5-8-18(13-19)26-21(28)16-10-11-20(25-14-16)15-6-4-7-17(24)12-15/h4,6-7,10-12,14,18-19H,5,8-9,13H2,1-3H3,(H,26,28)(H,27,29)/t18?,19-/m0/s1 |
| InChIKey | OVVQMRAKXJSORW-GGYWPGCISA-N |
| XLogP | 4.45 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |